Products 1805221-81-1
CAS 1805221-81-1 is the registry number for 4-Chloro-6-(difluoromethoxy)-3-pyridinecarboxylic acid, 96%, 96%. Offered by: Chemat. Available pack sizes: 100mg, 250mg.
4-chloro-6-(difluoromethoxy)pyridine-3-carboxylic acid (CAS 1805221-81-1) is a chemical compound with the molecular formula C7H4ClF2NO3 and a molecular weight of 223.56 g/mol. IUPAC name: 4-chloro-6-(difluoromethoxy)pyridine-3-carboxylic acid. InChIKey: DCSHVXKFGUQWJA-UHFFFAOYSA-N.
| Molecular formula | C7H4ClF2NO3 |
|---|---|
| Molecular weight | 223.56 g/mol |
| IUPAC name | 4-chloro-6-(difluoromethoxy)pyridine-3-carboxylic acid |
| InChIKey | DCSHVXKFGUQWJA-UHFFFAOYSA-N |
| SMILES | C1=C(C(=CN=C1OC(F)F)C(=O)O)Cl |
Computed by PubChem (NCBI)