CAS 1805372-15-9 is the registry number for Methyl 5-bromo-4-(difluoromethyl)-6-oxo-1,6-dihydropyridine-2-carboxylate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Methyl 5-bromo-4-(difluoromethyl)-6-oxo-1H-pyridine-2-carboxylate (CAS 1805372-15-9) is a chemical compound with the molecular formula C8H6BrF2NO3 and a molecular weight of 282.04 g/mol. IUPAC name: methyl 5-bromo-4-(difluoromethyl)-6-oxo-1H-pyridine-2-carboxylate. InChIKey: KAIKIRBKHPXKII-UHFFFAOYSA-N.
| Molecular formula | C8H6BrF2NO3 |
|---|---|
| Molecular weight | 282.04 g/mol |
| IUPAC name | methyl 5-bromo-4-(difluoromethyl)-6-oxo-1H-pyridine-2-carboxylate |
| InChIKey | KAIKIRBKHPXKII-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CC(=C(C(=O)N1)Br)C(F)F |
Computed by PubChem (NCBI)