Products 2901871-30-3
CAS 2901871-30-3 is the registry number for Methyl 5-bromo-6-(difluoromethoxy)picolinate, 95%. Offered by: Ambeed. Available pack sizes: 250mg, 1g.
Methyl 5-bromo-6-(difluoromethoxy)pyridine-2-carboxylate (CAS 2901871-30-3) is a chemical compound with the molecular formula C8H6BrF2NO3 and a molecular weight of 282.04 g/mol. IUPAC name: methyl 5-bromo-6-(difluoromethoxy)pyridine-2-carboxylate. InChIKey: SXELDHFVPJXJNP-UHFFFAOYSA-N.
| Molecular formula | C8H6BrF2NO3 |
|---|---|
| Molecular weight | 282.04 g/mol |
| IUPAC name | methyl 5-bromo-6-(difluoromethoxy)pyridine-2-carboxylate |
| InChIKey | SXELDHFVPJXJNP-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=NC(=C(C=C1)Br)OC(F)F |
Computed by PubChem (NCBI)