Products 1805473-01-1

CAS 1805473-01-1 is the registry number for Ethyl 5-bromo-3-nitropyridine-2-carboxylate. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.

Structural formula: {0} (CAS {1})

Ethyl 5-bromo-3-nitropyridine-2-carboxylate (CAS 1805473-01-1) is a chemical compound with the molecular formula C8H7BrN2O4 and a molecular weight of 275.06 g/mol. IUPAC name: ethyl 5-bromo-3-nitropyridine-2-carboxylate. InChIKey: NJQCNFDDESQTFQ-UHFFFAOYSA-N.

Identity
Molecular formulaC8H7BrN2O4
Molecular weight275.06 g/mol
IUPAC nameethyl 5-bromo-3-nitropyridine-2-carboxylate
InChIKeyNJQCNFDDESQTFQ-UHFFFAOYSA-N
SMILESCCOC(=O)C1=C(C=C(C=N1)Br)[N+](=O)[O-]

Computed by PubChem (NCBI)