Products 2377920-30-2
CAS 2377920-30-2 is the registry number for 2-(2-Bromo-4-nitrophenoxy)acetamide, 96%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
2-(2-bromo-4-nitrophenoxy)acetamide (CAS 2377920-30-2) is a chemical compound with the molecular formula C8H7BrN2O4 and a molecular weight of 275.06 g/mol. IUPAC name: 2-(2-bromo-4-nitrophenoxy)acetamide. InChIKey: IMUXWLZFMQLACZ-UHFFFAOYSA-N.
| Molecular formula | C8H7BrN2O4 |
|---|---|
| Molecular weight | 275.06 g/mol |
| IUPAC name | 2-(2-bromo-4-nitrophenoxy)acetamide |
| InChIKey | IMUXWLZFMQLACZ-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1[N+](=O)[O-])Br)OCC(=O)N |
Computed by PubChem (NCBI)