Products 1805478-79-8

CAS 1805478-79-8 appears in our catalog under these names: 3-Bromo-2-chloro-6-fluorobenzoyl chloride, 95%, 3-Bromo-2-chloro-6-fluorobenzoyl chloride, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 10g, 25g, 5g, 1g, 250mg.

Structural formula: {0} (CAS {1})

3-bromo-2-chloro-6-fluorobenzoyl chloride (CAS 1805478-79-8) is a chemical compound with the molecular formula C7H2BrCl2FO and a molecular weight of 271.89 g/mol. IUPAC name: 3-bromo-2-chloro-6-fluorobenzoyl chloride. InChIKey: FVQYKODVAZSGNZ-UHFFFAOYSA-N.

Identity
Molecular formulaC7H2BrCl2FO
Molecular weight271.89 g/mol
IUPAC name3-bromo-2-chloro-6-fluorobenzoyl chloride
InChIKeyFVQYKODVAZSGNZ-UHFFFAOYSA-N
SMILESC1=CC(=C(C(=C1F)C(=O)Cl)Cl)Br

Computed by PubChem (NCBI)