CAS 1805478-79-8 appears in our catalog under these names: 3-Bromo-2-chloro-6-fluorobenzoyl chloride, 95%, 3-Bromo-2-chloro-6-fluorobenzoyl chloride, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 10g, 25g, 5g, 1g, 250mg.
3-bromo-2-chloro-6-fluorobenzoyl chloride (CAS 1805478-79-8) is a chemical compound with the molecular formula C7H2BrCl2FO and a molecular weight of 271.89 g/mol. IUPAC name: 3-bromo-2-chloro-6-fluorobenzoyl chloride. InChIKey: FVQYKODVAZSGNZ-UHFFFAOYSA-N.
| Molecular formula | C7H2BrCl2FO |
|---|---|
| Molecular weight | 271.89 g/mol |
| IUPAC name | 3-bromo-2-chloro-6-fluorobenzoyl chloride |
| InChIKey | FVQYKODVAZSGNZ-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1F)C(=O)Cl)Cl)Br |
Computed by PubChem (NCBI)