CAS 2368910-21-6 is the registry number for 2-Bromo-3,4-dichloro-6-fluorobenzaldehyde, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
2-bromo-3,4-dichloro-6-fluorobenzaldehyde (CAS 2368910-21-6) is a chemical compound with the molecular formula C7H2BrCl2FO and a molecular weight of 271.89 g/mol. IUPAC name: 2-bromo-3,4-dichloro-6-fluorobenzaldehyde. InChIKey: MMOLSRAISVYFDO-UHFFFAOYSA-N.
| Molecular formula | C7H2BrCl2FO |
|---|---|
| Molecular weight | 271.89 g/mol |
| IUPAC name | 2-bromo-3,4-dichloro-6-fluorobenzaldehyde |
| InChIKey | MMOLSRAISVYFDO-UHFFFAOYSA-N |
| SMILES | C1=C(C(=C(C(=C1Cl)Cl)Br)C=O)F |
Computed by PubChem (NCBI)