Products 1805503-98-3
CAS 1805503-98-3 is the registry number for Methyl 3-bromo-2-fluoro-6-nitrobenzoate, 95%, 95%. Offered by: Chemat. Available pack sizes: 1g, 5g, 10g.
Methyl 3-bromo-2-fluoro-6-nitrobenzoate (CAS 1805503-98-3) is a chemical compound with the molecular formula C8H5BrFNO4 and a molecular weight of 278.03 g/mol. IUPAC name: methyl 3-bromo-2-fluoro-6-nitrobenzoate. InChIKey: IXKPBPDUWKECDD-UHFFFAOYSA-N.
| Molecular formula | C8H5BrFNO4 |
|---|---|
| Molecular weight | 278.03 g/mol |
| IUPAC name | methyl 3-bromo-2-fluoro-6-nitrobenzoate |
| InChIKey | IXKPBPDUWKECDD-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=C(C=CC(=C1F)Br)[N+](=O)[O-] |
Computed by PubChem (NCBI)