CAS 1805508-51-3 is the registry number for 3-Bromo-6-fluoro-2-nitropyridine. Offered by: TRC. Available pack sizes: 750mg.
3-bromo-6-fluoro-2-nitropyridine (CAS 1805508-51-3) is a chemical compound with the molecular formula C5H2BrFN2O2 and a molecular weight of 220.98 g/mol. IUPAC name: 3-bromo-6-fluoro-2-nitropyridine. InChIKey: NIYGJUSTJDWLMB-UHFFFAOYSA-N.
| Molecular formula | C5H2BrFN2O2 |
|---|---|
| Molecular weight | 220.98 g/mol |
| IUPAC name | 3-bromo-6-fluoro-2-nitropyridine |
| InChIKey | NIYGJUSTJDWLMB-UHFFFAOYSA-N |
| SMILES | C1=CC(=NC(=C1Br)[N+](=O)[O-])F |
Computed by PubChem (NCBI)