CAS 1807072-92-9 appears in our catalog under these names: 2-Bromo-3-fluoro-4-nitropyridine 97%, 2-Bromo-3-fluoro-4-nitropyridine, 97%, 97%, 2-BROMO-3-FLUORO-4-NITROPYRIDINE, 97%. Offered by: Ambeed, Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g, 5g.
2-bromo-3-fluoro-4-nitropyridine (CAS 1807072-92-9) is a chemical compound with the molecular formula C5H2BrFN2O2 and a molecular weight of 220.98 g/mol. IUPAC name: 2-bromo-3-fluoro-4-nitropyridine. InChIKey: QEBVNLSQEHSZHE-UHFFFAOYSA-N.
| Molecular formula | C5H2BrFN2O2 |
|---|---|
| Molecular weight | 220.98 g/mol |
| IUPAC name | 2-bromo-3-fluoro-4-nitropyridine |
| InChIKey | QEBVNLSQEHSZHE-UHFFFAOYSA-N |
| SMILES | C1=CN=C(C(=C1[N+](=O)[O-])F)Br |
Computed by PubChem (NCBI)