Products 1805509-46-9
CAS 1805509-46-9 is the registry number for Methyl 4-amino-6-(trifluoromethyl)-3-pyridinecarboxylate, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
Methyl 4-amino-6-(trifluoromethyl)pyridine-3-carboxylate (CAS 1805509-46-9) is a chemical compound with the molecular formula C8H7F3N2O2 and a molecular weight of 220.15 g/mol. IUPAC name: methyl 4-amino-6-(trifluoromethyl)pyridine-3-carboxylate. InChIKey: TZWIDKVVNWDCMG-UHFFFAOYSA-N.
| Molecular formula | C8H7F3N2O2 |
|---|---|
| Molecular weight | 220.15 g/mol |
| IUPAC name | methyl 4-amino-6-(trifluoromethyl)pyridine-3-carboxylate |
| InChIKey | TZWIDKVVNWDCMG-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CN=C(C=C1N)C(F)(F)F |
Computed by PubChem (NCBI)