Products 1805594-59-5
CAS 1805594-59-5 is the registry number for Ethyl 3-bromo-4-cyano-5-(trifluoromethyl)benzoate, 95%. Offered by: Ambeed. Available pack sizes: 25mg, 50mg, 100mg, 250mg, 1g.
Ethyl 3-bromo-4-cyano-5-(trifluoromethyl)benzoate (CAS 1805594-59-5) is a chemical compound with the molecular formula C11H7BrF3NO2 and a molecular weight of 322.08 g/mol. IUPAC name: ethyl 3-bromo-4-cyano-5-(trifluoromethyl)benzoate. InChIKey: SFZUYOLMMNYDHW-UHFFFAOYSA-N.
| Molecular formula | C11H7BrF3NO2 |
|---|---|
| Molecular weight | 322.08 g/mol |
| IUPAC name | ethyl 3-bromo-4-cyano-5-(trifluoromethyl)benzoate |
| InChIKey | SFZUYOLMMNYDHW-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=CC(=C(C(=C1)Br)C#N)C(F)(F)F |
Computed by PubChem (NCBI)