Products 2279122-30-2
CAS 2279122-30-2 is the registry number for 6-Bromo-1-(2,2,2-trifluoro-ethyl)-1h-indole-4-carboxylic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
6-bromo-1-(2,2,2-trifluoroethyl)indole-4-carboxylic acid (CAS 2279122-30-2) is a chemical compound with the molecular formula C11H7BrF3NO2 and a molecular weight of 322.08 g/mol. IUPAC name: 6-bromo-1-(2,2,2-trifluoroethyl)indole-4-carboxylic acid. InChIKey: VUDMFKJUFFINGN-UHFFFAOYSA-N.
| Molecular formula | C11H7BrF3NO2 |
|---|---|
| Molecular weight | 322.08 g/mol |
| IUPAC name | 6-bromo-1-(2,2,2-trifluoroethyl)indole-4-carboxylic acid |
| InChIKey | VUDMFKJUFFINGN-UHFFFAOYSA-N |
| SMILES | C1=CN(C2=CC(=CC(=C21)C(=O)O)Br)CC(F)(F)F |
Computed by PubChem (NCBI)