CAS 1805648-70-7 is the registry number for 3-chloro-2-methoxy-4-nitropyridine, 98%. Offered by: Combi-blocks, AmBeed, Fluorochem. Available pack sizes: 250mg, 1g, 100mg.
3-chloro-2-methoxy-4-nitropyridine (CAS 1805648-70-7) is a chemical compound with the molecular formula C6H5ClN2O3 and a molecular weight of 188.57 g/mol. IUPAC name: 3-chloro-2-methoxy-4-nitropyridine. InChIKey: MUPXCASLDHKDMW-UHFFFAOYSA-N.
| Molecular formula | C6H5ClN2O3 |
|---|---|
| Molecular weight | 188.57 g/mol |
| IUPAC name | 3-chloro-2-methoxy-4-nitropyridine |
| InChIKey | MUPXCASLDHKDMW-UHFFFAOYSA-N |
| SMILES | COC1=NC=CC(=C1Cl)[N+](=O)[O-] |
Computed by PubChem (NCBI)