CAS 1806332-88-6 is the registry number for Methyl 4–fluoro–2,5–dimethylbenzoate. Offered by: GLPBio. Available pack sizes: 100mg, 1g, 250mg.
Methyl 4-fluoro-2,5-dimethylbenzoate (CAS 1806332-88-6) is a chemical compound with the molecular formula C10H11FO2 and a molecular weight of 182.19 g/mol. IUPAC name: methyl 4-fluoro-2,5-dimethylbenzoate. InChIKey: PMACGWQVSUQHTO-UHFFFAOYSA-N.
| Molecular formula | C10H11FO2 |
|---|---|
| Molecular weight | 182.19 g/mol |
| IUPAC name | methyl 4-fluoro-2,5-dimethylbenzoate |
| InChIKey | PMACGWQVSUQHTO-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C=C1F)C)C(=O)OC |
Computed by PubChem (NCBI)