Products 1806332-88-6

CAS 1806332-88-6 is the registry number for Methyl 4–fluoro–2,5–dimethylbenzoate. Offered by: GLPBio. Available pack sizes: 100mg, 1g, 250mg.

Structural formula: {0} (CAS {1})

Methyl 4-fluoro-2,5-dimethylbenzoate (CAS 1806332-88-6) is a chemical compound with the molecular formula C10H11FO2 and a molecular weight of 182.19 g/mol. IUPAC name: methyl 4-fluoro-2,5-dimethylbenzoate. InChIKey: PMACGWQVSUQHTO-UHFFFAOYSA-N.

Identity
Molecular formulaC10H11FO2
Molecular weight182.19 g/mol
IUPAC namemethyl 4-fluoro-2,5-dimethylbenzoate
InChIKeyPMACGWQVSUQHTO-UHFFFAOYSA-N
SMILESCC1=CC(=C(C=C1F)C)C(=O)OC

Computed by PubChem (NCBI)