CAS 1806424-25-8 appears in our catalog under these names: 4-fluoro-1,3-benzoxazol-2-amine, 98%, 4-Fluorobenzo(d)oxazol-2-amine, 98%, 4-Fluoro-1,3-benzoxazol-2-amine. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 5g, 10g, 250mg, 1g, 100mg.
4-fluoro-1,3-benzoxazol-2-amine (CAS 1806424-25-8) is a chemical compound with the molecular formula C7H5FN2O and a molecular weight of 152.13 g/mol. IUPAC name: 4-fluoro-1,3-benzoxazol-2-amine. InChIKey: ZIBMOOAPLHTWBT-UHFFFAOYSA-N.
| Molecular formula | C7H5FN2O |
|---|---|
| Molecular weight | 152.13 g/mol |
| IUPAC name | 4-fluoro-1,3-benzoxazol-2-amine |
| InChIKey | ZIBMOOAPLHTWBT-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C(=C1)F)N=C(O2)N |
Computed by PubChem (NCBI)