CAS 1807-68-7 is the registry number for Diazodimedone, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 250mg, 10g, 1g, 100mg.
2-diazo-5,5-dimethylcyclohexane-1,3-dione (CAS 1807-68-7) is a chemical compound with the molecular formula C8H10N2O2 and a molecular weight of 166.18 g/mol. IUPAC name: 2-diazo-5,5-dimethylcyclohexane-1,3-dione. InChIKey: DMOYBIUAWCVPLF-UHFFFAOYSA-N.
| Molecular formula | C8H10N2O2 |
|---|---|
| Molecular weight | 166.18 g/mol |
| IUPAC name | 2-diazo-5,5-dimethylcyclohexane-1,3-dione |
| InChIKey | DMOYBIUAWCVPLF-UHFFFAOYSA-N |
| SMILES | CC1(CC(=O)C(=[N+]=[N-])C(=O)C1)C |
Computed by PubChem (NCBI)