Products 1807-68-7

CAS 1807-68-7 is the registry number for Diazodimedone, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 250mg, 10g, 1g, 100mg.

Structural formula: {0} (CAS {1})

2-diazo-5,5-dimethylcyclohexane-1,3-dione (CAS 1807-68-7) is a chemical compound with the molecular formula C8H10N2O2 and a molecular weight of 166.18 g/mol. IUPAC name: 2-diazo-5,5-dimethylcyclohexane-1,3-dione. InChIKey: DMOYBIUAWCVPLF-UHFFFAOYSA-N.

Identity
Molecular formulaC8H10N2O2
Molecular weight166.18 g/mol
IUPAC name2-diazo-5,5-dimethylcyclohexane-1,3-dione
InChIKeyDMOYBIUAWCVPLF-UHFFFAOYSA-N
SMILESCC1(CC(=O)C(=[N+]=[N-])C(=O)C1)C

Computed by PubChem (NCBI)