CAS 1807168-91-7 is the registry number for 3-Bromo-2,4-difluorophenacyl bromide, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
2-bromo-1-(3-bromo-2,4-difluorophenyl)ethanone (CAS 1807168-91-7) is a chemical compound with the molecular formula C8H4Br2F2O and a molecular weight of 313.92 g/mol. IUPAC name: 2-bromo-1-(3-bromo-2,4-difluorophenyl)ethanone. InChIKey: READNKONIKOFDY-UHFFFAOYSA-N.
| Molecular formula | C8H4Br2F2O |
|---|---|
| Molecular weight | 313.92 g/mol |
| IUPAC name | 2-bromo-1-(3-bromo-2,4-difluorophenyl)ethanone |
| InChIKey | READNKONIKOFDY-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1C(=O)CBr)F)Br)F |
Computed by PubChem (NCBI)