CAS 1889194-56-2 is the registry number for 2,2-Dibromo-1-(3,4-difluorophenyl)ethan-1-one, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
2,2-dibromo-1-(3,4-difluorophenyl)ethanone (CAS 1889194-56-2) is a chemical compound with the molecular formula C8H4Br2F2O and a molecular weight of 313.92 g/mol. IUPAC name: 2,2-dibromo-1-(3,4-difluorophenyl)ethanone. InChIKey: GXDTXYADZMIHJD-UHFFFAOYSA-N.
| Molecular formula | C8H4Br2F2O |
|---|---|
| Molecular weight | 313.92 g/mol |
| IUPAC name | 2,2-dibromo-1-(3,4-difluorophenyl)ethanone |
| InChIKey | GXDTXYADZMIHJD-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1C(=O)C(Br)Br)F)F |
Computed by PubChem (NCBI)