Products 1807179-76-5
CAS 1807179-76-5 appears in our catalog under these names: 1，3–Dichloro–5–fluoro–2–(trifluoromethyl)benzene, 1,3-Dichloro-5-fluoro-2-(trifluoromethyl)benzene, 97%. Offered by: GLPBio, Fluorochem, Ambeed. Available pack sizes: 100mg, 250mg, 1g, 5g.
1,3-dichloro-5-fluoro-2-(trifluoromethyl)benzene (CAS 1807179-76-5) is a chemical compound with the molecular formula C7H2Cl2F4 and a molecular weight of 232.99 g/mol. IUPAC name: 1,3-dichloro-5-fluoro-2-(trifluoromethyl)benzene. InChIKey: LDFIIGQPVHNLOQ-UHFFFAOYSA-N.
| Molecular formula | C7H2Cl2F4 |
|---|---|
| Molecular weight | 232.99 g/mol |
| IUPAC name | 1,3-dichloro-5-fluoro-2-(trifluoromethyl)benzene |
| InChIKey | LDFIIGQPVHNLOQ-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C(=C1Cl)C(F)(F)F)Cl)F |
Computed by PubChem (NCBI)