Products 112290-01-4
CAS 112290-01-4 appears in our catalog under these names: 1,5-Dichloro-2-fluoro-4-trifluoromethyl-benzene, 95%, 2,4-Dichloro-5-fluorobenzotrifluoride, 95%. Offered by: Fluorochem, Combi-blocks. Available pack sizes: 5g, 10g, 1g.
1,5-dichloro-2-fluoro-4-(trifluoromethyl)benzene (CAS 112290-01-4) is a chemical compound with the molecular formula C7H2Cl2F4 and a molecular weight of 232.99 g/mol. IUPAC name: 1,5-dichloro-2-fluoro-4-(trifluoromethyl)benzene. InChIKey: DMBPTCKJFRNICI-UHFFFAOYSA-N.
| Molecular formula | C7H2Cl2F4 |
|---|---|
| Molecular weight | 232.99 g/mol |
| IUPAC name | 1,5-dichloro-2-fluoro-4-(trifluoromethyl)benzene |
| InChIKey | DMBPTCKJFRNICI-UHFFFAOYSA-N |
| SMILES | C1=C(C(=CC(=C1F)Cl)Cl)C(F)(F)F |
Computed by PubChem (NCBI)