Products 1807215-92-4
CAS 1807215-92-4 is the registry number for 5-(Bromomethyl)-2-chloro-3-(trifluoromethyl)pyridine, 97%. Offered by: Ambeed. Available pack sizes: 50mg, 100mg, 250mg, 1g.
5-(bromomethyl)-2-chloro-3-(trifluoromethyl)pyridine (CAS 1807215-92-4) is a chemical compound with the molecular formula C7H4BrClF3N and a molecular weight of 274.46 g/mol. IUPAC name: 5-(bromomethyl)-2-chloro-3-(trifluoromethyl)pyridine. InChIKey: QCNUMDICQFJVJK-UHFFFAOYSA-N.
| Molecular formula | C7H4BrClF3N |
|---|---|
| Molecular weight | 274.46 g/mol |
| IUPAC name | 5-(bromomethyl)-2-chloro-3-(trifluoromethyl)pyridine |
| InChIKey | QCNUMDICQFJVJK-UHFFFAOYSA-N |
| SMILES | C1=C(C=NC(=C1C(F)(F)F)Cl)CBr |
Computed by PubChem (NCBI)