Products 61019-26-9

CAS 61019-26-9 is the registry number for 4-Amino-5-(2-methoxy-phenyl)-4h-[1,2,4]triazole-3-thiol, 95%. Offered by: Combi-blocks, Fluorochem. Available pack sizes: 10g, 5g, 1g, 250mg, 2.5g.

Structural formula: {0} (CAS {1})

4-amino-3-(2-methoxyphenyl)-1H-1,2,4-triazole-5-thione (CAS 61019-26-9) is a chemical compound with the molecular formula C9H10N4OS and a molecular weight of 222.27 g/mol. IUPAC name: 4-amino-3-(2-methoxyphenyl)-1H-1,2,4-triazole-5-thione. InChIKey: LIXZCJPZWGBBKO-UHFFFAOYSA-N.

Identity
Molecular formulaC9H10N4OS
Molecular weight222.27 g/mol
IUPAC name4-amino-3-(2-methoxyphenyl)-1H-1,2,4-triazole-5-thione
InChIKeyLIXZCJPZWGBBKO-UHFFFAOYSA-N
SMILESCOC1=CC=CC=C1C2=NNC(=S)N2N

Computed by PubChem (NCBI)