Products 1807453-72-0
CAS 1807453-72-0 is the registry number for ND-378. Offered by: MedChemExpress. Available pack sizes: Get quote.
N-[[4-[4-(thiiran-2-ylmethylsulfonyl)phenoxy]phenyl]methyl]acetamide (CAS 1807453-72-0) is a chemical compound with the molecular formula C18H19NO4S2 and a molecular weight of 377.5 g/mol. IUPAC name: N-[[4-[4-(thiiran-2-ylmethylsulfonyl)phenoxy]phenyl]methyl]acetamide. InChIKey: AQVLOPBRNWYJSU-UHFFFAOYSA-N.
| Molecular formula | C18H19NO4S2 |
|---|---|
| Molecular weight | 377.5 g/mol |
| IUPAC name | N-[[4-[4-(thiiran-2-ylmethylsulfonyl)phenoxy]phenyl]methyl]acetamide |
| InChIKey | AQVLOPBRNWYJSU-UHFFFAOYSA-N |
| SMILES | CC(=O)NCC1=CC=C(C=C1)OC2=CC=C(C=C2)S(=O)(=O)CC3CS3 |
Computed by PubChem (NCBI)