CAS 1807501-82-1 appears in our catalog under these names: Endo-bcn-peg3-acid, 95%, endo–BCN–PEG3–acid, endo-BCN-PEG3-acid, 98%, 98%, endo-BCN-PEG3-acid, 98.60%, endo-BCN-PEG3-acid 98%. Offered by: Combi-blocks, GLPBio, Chemat, MedChemExpress, Ambeed. Available pack sizes: 100mg, 250mg, 10mg, 25mg, 50mg, 100 mg, 50 mg, 1g.
3-[2-[2-[2-(9-bicyclo[6.1.0]non-4-ynylmethoxycarbonylamino)ethoxy]ethoxy]ethoxy]propanoic acid (CAS 1807501-82-1) is a chemical compound with the molecular formula C20H31NO7 and a molecular weight of 397.5 g/mol. IUPAC name: 3-[2-[2-[2-(9-bicyclo[6.1.0]non-4-ynylmethoxycarbonylamino)ethoxy]ethoxy]ethoxy]propanoic acid. InChIKey: NRDCHHRLBMBFHZ-UHFFFAOYSA-N.
| Molecular formula | C20H31NO7 |
|---|---|
| Molecular weight | 397.5 g/mol |
| IUPAC name | 3-[2-[2-[2-(9-bicyclo[6.1.0]non-4-ynylmethoxycarbonylamino)ethoxy]ethoxy]ethoxy]propanoic acid |
| InChIKey | NRDCHHRLBMBFHZ-UHFFFAOYSA-N |
| SMILES | C1CC2C(C2COC(=O)NCCOCCOCCOCCC(=O)O)CCC#C1 |
Computed by PubChem (NCBI)