Products 313471-75-9
CAS 313471-75-9 is the registry number for Desvenlafaxine fumarate. Offered by: Biosynth. Available pack sizes: 500mg.
(E)-but-2-enedioic acid;4-[2-(dimethylamino)-1-(1-hydroxycyclohexyl)ethyl]phenol;hydrate (CAS 313471-75-9) is a chemical compound with the molecular formula C20H31NO7 and a molecular weight of 397.5 g/mol. IUPAC name: (E)-but-2-enedioic acid;4-[2-(dimethylamino)-1-(1-hydroxycyclohexyl)ethyl]phenol;hydrate. InChIKey: YETWCSLOYUZBLK-JITBQSAISA-N.
| Molecular formula | C20H31NO7 |
|---|---|
| Molecular weight | 397.5 g/mol |
| IUPAC name | (E)-but-2-enedioic acid;4-[2-(dimethylamino)-1-(1-hydroxycyclohexyl)ethyl]phenol;hydrate |
| InChIKey | YETWCSLOYUZBLK-JITBQSAISA-N |
| SMILES | CN(C)CC(C1=CC=C(C=C1)O)C2(CCCCC2)O.C(=C/C(=O)O)\C(=O)O.O |
Computed by PubChem (NCBI)