CAS 1807699-68-8 appears in our catalog under these names: 2-(Chroman-7-yl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane, 95%, 2-(Chroman-7-yl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane, 95+%, chroman-7-ylboronic acid pinacol ester, 2-(Chroman-7-yl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane, 97%, 97%, CHROMAN-7-YLBORONIC ACID PINACOL ESTER, 95+%. Offered by: Combi-blocks, AmBeed, Biosynth, Chemat, Fluorochem. Available pack sizes: 1g, 250mg, 0,5g, 50mg, 100mg, 500mg.
2-(3,4-dihydro-2H-chromen-7-yl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (CAS 1807699-68-8) is a chemical compound with the molecular formula C15H21BO3 and a molecular weight of 260.14 g/mol. IUPAC name: 2-(3,4-dihydro-2H-chromen-7-yl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane. InChIKey: GDPPCKJRFJDEJN-UHFFFAOYSA-N.
| Molecular formula | C15H21BO3 |
|---|---|
| Molecular weight | 260.14 g/mol |
| IUPAC name | 2-(3,4-dihydro-2H-chromen-7-yl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| InChIKey | GDPPCKJRFJDEJN-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC3=C(CCCO3)C=C2 |
Computed by PubChem (NCBI)