CAS 1807724-51-1 is the registry number for 1-(2,6-dichloro-4-(trifluoromethyl)phenyl)ethanol, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
1-[2,6-dichloro-4-(trifluoromethyl)phenyl]ethanol (CAS 1807724-51-1) is a chemical compound with the molecular formula C9H7Cl2F3O and a molecular weight of 259.05 g/mol. IUPAC name: 1-[2,6-dichloro-4-(trifluoromethyl)phenyl]ethanol. InChIKey: LDOAEGMWRCVPDE-UHFFFAOYSA-N.
| Molecular formula | C9H7Cl2F3O |
|---|---|
| Molecular weight | 259.05 g/mol |
| IUPAC name | 1-[2,6-dichloro-4-(trifluoromethyl)phenyl]ethanol |
| InChIKey | LDOAEGMWRCVPDE-UHFFFAOYSA-N |
| SMILES | CC(C1=C(C=C(C=C1Cl)C(F)(F)F)Cl)O |
Computed by PubChem (NCBI)