CAS 239074-65-8 is the registry number for 3,3-Dichloro-1,1,1-trifluoro-2-phenylpropan-2-ol, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g.
3,3-dichloro-1,1,1-trifluoro-2-phenylpropan-2-ol (CAS 239074-65-8) is a chemical compound with the molecular formula C9H7Cl2F3O and a molecular weight of 259.05 g/mol. IUPAC name: 3,3-dichloro-1,1,1-trifluoro-2-phenylpropan-2-ol. InChIKey: AAJFTUIEAYJREB-UHFFFAOYSA-N.
| Molecular formula | C9H7Cl2F3O |
|---|---|
| Molecular weight | 259.05 g/mol |
| IUPAC name | 3,3-dichloro-1,1,1-trifluoro-2-phenylpropan-2-ol |
| InChIKey | AAJFTUIEAYJREB-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C(C(Cl)Cl)(C(F)(F)F)O |
Computed by PubChem (NCBI)