Products 1807890-94-3
CAS 1807890-94-3 is the registry number for rac-2-Methyl-6-{1-((1R,2R)-2-methylcyclopropyl)-1H-1,2,3,4-tetrazol-5-yl}aniline. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
2-methyl-6-[1-[(1R,2R)-2-methylcyclopropyl]tetrazol-5-yl]aniline (CAS 1807890-94-3) is a chemical compound with the molecular formula C12H15N5 and a molecular weight of 229.28 g/mol. IUPAC name: 2-methyl-6-[1-[(1R,2R)-2-methylcyclopropyl]tetrazol-5-yl]aniline. InChIKey: YIPMPPICXHAXPP-PSASIEDQSA-N.
| Molecular formula | C12H15N5 |
|---|---|
| Molecular weight | 229.28 g/mol |
| IUPAC name | 2-methyl-6-[1-[(1R,2R)-2-methylcyclopropyl]tetrazol-5-yl]aniline |
| InChIKey | YIPMPPICXHAXPP-PSASIEDQSA-N |
| SMILES | C[C@@H]1C[C@H]1N2C(=NN=N2)C3=CC=CC(=C3N)C |
Computed by PubChem (NCBI)