CAS 878027-73-7 appears in our catalog under these names: 1-Butyl-3-methylimidazolium tricyanomethanide, 95%, 1–Butyl–3–methylimidazolium Tricyanomethanide, 1-Butyl-3-methylimidazolium Tricyanomethanide, >98.0%(HPLC)(N), 1-Butyl-3-methylimidazolium Tricyanomethanide. Offered by: Combi-blocks, GLPBio, TCI, Chemat. Available pack sizes: 25g, 5g, 1g.
1-butyl-3-methylimidazol-3-ium;2,2-dicyanoethenylideneazanide (CAS 878027-73-7) is a chemical compound with the molecular formula C12H15N5 and a molecular weight of 229.28 g/mol. IUPAC name: 1-butyl-3-methylimidazol-3-ium;2,2-dicyanoethenylideneazanide. InChIKey: YUDSETQBLNHGHF-UHFFFAOYSA-N.
| Molecular formula | C12H15N5 |
|---|---|
| Molecular weight | 229.28 g/mol |
| IUPAC name | 1-butyl-3-methylimidazol-3-ium;2,2-dicyanoethenylideneazanide |
| InChIKey | YUDSETQBLNHGHF-UHFFFAOYSA-N |
| SMILES | CCCCN1C=C[N+](=C1)C.C(=C(C#N)C#N)=[N-] |
Computed by PubChem (NCBI)