Products 1807896-11-2
CAS 1807896-11-2 is the registry number for (2S,3S)-3-Methyl-2-((1-methyl-2-oxo-1,2-dihydropyridin-4-yl)formamido)pentanoic acid. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
(2S,3S)-3-methyl-2-[(1-methyl-2-oxopyridine-4-carbonyl)amino]pentanoic acid (CAS 1807896-11-2) is a chemical compound with the molecular formula C13H18N2O4 and a molecular weight of 266.29 g/mol. IUPAC name: (2S,3S)-3-methyl-2-[(1-methyl-2-oxopyridine-4-carbonyl)amino]pentanoic acid. InChIKey: RDYDCVRECMUTNY-KWQFWETISA-N.
| Molecular formula | C13H18N2O4 |
|---|---|
| Molecular weight | 266.29 g/mol |
| IUPAC name | (2S,3S)-3-methyl-2-[(1-methyl-2-oxopyridine-4-carbonyl)amino]pentanoic acid |
| InChIKey | RDYDCVRECMUTNY-KWQFWETISA-N |
| SMILES | CC[C@H](C)[C@@H](C(=O)O)NC(=O)C1=CC(=O)N(C=C1)C |
Computed by PubChem (NCBI)