Products 1807912-17-9
CAS 1807912-17-9 is the registry number for 3-(Dimethylamino)-2-(ethanesulfonyl)prop-2-enenitrile. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
(E)-3-(dimethylamino)-2-ethylsulfonylprop-2-enenitrile (CAS 1807912-17-9) is a chemical compound with the molecular formula C7H12N2O2S and a molecular weight of 188.25 g/mol. IUPAC name: (E)-3-(dimethylamino)-2-ethylsulfonylprop-2-enenitrile. InChIKey: CCJKOUSJVJKNEZ-VOTSOKGWSA-N.
| Molecular formula | C7H12N2O2S |
|---|---|
| Molecular weight | 188.25 g/mol |
| IUPAC name | (E)-3-(dimethylamino)-2-ethylsulfonylprop-2-enenitrile |
| InChIKey | CCJKOUSJVJKNEZ-VOTSOKGWSA-N |
| SMILES | CCS(=O)(=O)/C(=C/N(C)C)/C#N |
Computed by PubChem (NCBI)