CAS 1932223-41-0 is the registry number for Rac-[(4s,6r)-6-methyl-2-thioxohexahydropyrimidin-4-yl]acetic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 10g, 5g, 1g.
2-[(4S,6R)-6-methyl-2-sulfanylidene-1,3-diazinan-4-yl]acetic acid (CAS 1932223-41-0) is a chemical compound with the molecular formula C7H12N2O2S and a molecular weight of 188.25 g/mol. IUPAC name: 2-[(4S,6R)-6-methyl-2-sulfanylidene-1,3-diazinan-4-yl]acetic acid. InChIKey: VWVFOUCGKCYTEJ-UHNVWZDZSA-N.
| Molecular formula | C7H12N2O2S |
|---|---|
| Molecular weight | 188.25 g/mol |
| IUPAC name | 2-[(4S,6R)-6-methyl-2-sulfanylidene-1,3-diazinan-4-yl]acetic acid |
| InChIKey | VWVFOUCGKCYTEJ-UHNVWZDZSA-N |
| SMILES | C[C@@H]1C[C@H](NC(=S)N1)CC(=O)O |
Computed by PubChem (NCBI)