CAS 1807920-94-0 is the registry number for rac-(2R,3R)-2-(1-(2-Methylphenyl)-1H-pyrazol-5-yl)oxolane-3-carboxylic acid. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
(2R,3R)-2-[2-(2-methylphenyl)pyrazol-3-yl]oxolane-3-carboxylic acid (CAS 1807920-94-0) is a chemical compound with the molecular formula C15H16N2O3 and a molecular weight of 272.30 g/mol. IUPAC name: (2R,3R)-2-[2-(2-methylphenyl)pyrazol-3-yl]oxolane-3-carboxylic acid. InChIKey: GIJJCJWKEQFUJD-BXUZGUMPSA-N.
| Molecular formula | C15H16N2O3 |
|---|---|
| Molecular weight | 272.30 g/mol |
| IUPAC name | (2R,3R)-2-[2-(2-methylphenyl)pyrazol-3-yl]oxolane-3-carboxylic acid |
| InChIKey | GIJJCJWKEQFUJD-BXUZGUMPSA-N |
| SMILES | CC1=CC=CC=C1N2C(=CC=N2)[C@H]3[C@@H](CCO3)C(=O)O |
Computed by PubChem (NCBI)