Products 1807938-57-3
CAS 1807938-57-3 is the registry number for (2R)-2-Hydroxy-2,6,6-trimethylbicyclo(3.1.1)heptan-3-one. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
(2R)-2-hydroxy-2,6,6-trimethylbicyclo[3.1.1]heptan-3-one (CAS 1807938-57-3) is a chemical compound with the molecular formula C10H16O2 and a molecular weight of 168.23 g/mol. IUPAC name: (2R)-2-hydroxy-2,6,6-trimethylbicyclo[3.1.1]heptan-3-one. InChIKey: VZRRCQOUNSHSGB-HNQUHTCLSA-N.
| Molecular formula | C10H16O2 |
|---|---|
| Molecular weight | 168.23 g/mol |
| IUPAC name | (2R)-2-hydroxy-2,6,6-trimethylbicyclo[3.1.1]heptan-3-one |
| InChIKey | VZRRCQOUNSHSGB-HNQUHTCLSA-N |
| SMILES | C[C@]1(C2CC(C2(C)C)CC1=O)O |
Computed by PubChem (NCBI)