CAS 1807939-51-0 is the registry number for rac-(1R,2R)-2-Methanesulfonylcyclohexan-1-amine hydrochloride. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
Trans-(1R,2R)-2-methylsulfonylcyclohexan-1-amine;hydrochloride (CAS 1807939-51-0) is a chemical compound with the molecular formula C7H16ClNO2S and a molecular weight of 213.73 g/mol. IUPAC name: trans-(1R,2R)-2-methylsulfonylcyclohexan-1-amine;hydrochloride. InChIKey: IVHIXTAXUMILDJ-ZJLYAJKPSA-N.
| Molecular formula | C7H16ClNO2S |
|---|---|
| Molecular weight | 213.73 g/mol |
| IUPAC name | trans-(1R,2R)-2-methylsulfonylcyclohexan-1-amine;hydrochloride |
| InChIKey | IVHIXTAXUMILDJ-ZJLYAJKPSA-N |
| SMILES | CS(=O)(=O)[C@@H]1CCCC[C@H]1N.Cl |
Computed by PubChem (NCBI)