Products 1807939-61-2
CAS 1807939-61-2 is the registry number for rac-(2R,3R)-1-Methyl-2-(1-methyl-1H-pyrazol-5-yl)-6-oxopiperidine-3-carboxamide. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
(2S,3S)-1-methyl-2-(2-methylpyrazol-3-yl)-6-oxopiperidine-3-carboxamide (CAS 1807939-61-2) is a chemical compound with the molecular formula C11H16N4O2 and a molecular weight of 236.27 g/mol. IUPAC name: (2S,3S)-1-methyl-2-(2-methylpyrazol-3-yl)-6-oxopiperidine-3-carboxamide. InChIKey: PKDROEAQLLQUOB-XVKPBYJWSA-N.
| Molecular formula | C11H16N4O2 |
|---|---|
| Molecular weight | 236.27 g/mol |
| IUPAC name | (2S,3S)-1-methyl-2-(2-methylpyrazol-3-yl)-6-oxopiperidine-3-carboxamide |
| InChIKey | PKDROEAQLLQUOB-XVKPBYJWSA-N |
| SMILES | CN1[C@@H]([C@H](CCC1=O)C(=O)N)C2=CC=NN2C |
Computed by PubChem (NCBI)