CAS 1807939-66-7 is the registry number for rac-(4aR,8aS)-4-Benzyl-decahydroquinoxalin-2-one. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
(4aR,8aS)-4-benzyl-1,3,4a,5,6,7,8,8a-octahydroquinoxalin-2-one (CAS 1807939-66-7) is a chemical compound with the molecular formula C15H20N2O and a molecular weight of 244.33 g/mol. IUPAC name: (4aR,8aS)-4-benzyl-1,3,4a,5,6,7,8,8a-octahydroquinoxalin-2-one. InChIKey: JSFYAZUQEZPWOZ-UONOGXRCSA-N.
| Molecular formula | C15H20N2O |
|---|---|
| Molecular weight | 244.33 g/mol |
| IUPAC name | (4aR,8aS)-4-benzyl-1,3,4a,5,6,7,8,8a-octahydroquinoxalin-2-one |
| InChIKey | JSFYAZUQEZPWOZ-UONOGXRCSA-N |
| SMILES | C1CC[C@@H]2[C@H](C1)NC(=O)CN2CC3=CC=CC=C3 |
Computed by PubChem (NCBI)