CAS 1807939-97-4 appears in our catalog under these names: 3-(3-Fluoro-4-methoxyphenyl)cyclobutan-1-amine hydrochloride, (1R,3r)-3-(3-fluoro-4-methoxyphenyl)cyclobutan-1-amine hydrochloride, 98%. Offered by: Biosynth, AmBeed. Available pack sizes: 0,5g, 50mg, 1g.
3-(3-fluoro-4-methoxyphenyl)cyclobutan-1-amine;hydrochloride (CAS 1807939-97-4) is a chemical compound with the molecular formula C11H15ClFNO and a molecular weight of 231.69 g/mol. IUPAC name: 3-(3-fluoro-4-methoxyphenyl)cyclobutan-1-amine;hydrochloride. InChIKey: GUPQBGLLIHTTKG-UHFFFAOYSA-N.
| Molecular formula | C11H15ClFNO |
|---|---|
| Molecular weight | 231.69 g/mol |
| IUPAC name | 3-(3-fluoro-4-methoxyphenyl)cyclobutan-1-amine;hydrochloride |
| InChIKey | GUPQBGLLIHTTKG-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C(C=C1)C2CC(C2)N)F.Cl |
Computed by PubChem (NCBI)