CAS 1807972-53-7 is the registry number for 5-Chloro-4-fluoro-2-(tetramethyl-1,3,2-dioxaborolan-2-yl)aniline, 95%. Offered by: Combi-blocks. Available pack sizes: 1g.
5-chloro-4-fluoro-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)aniline (CAS 1807972-53-7) is a chemical compound with the molecular formula C12H16BClFNO2 and a molecular weight of 271.52 g/mol. IUPAC name: 5-chloro-4-fluoro-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)aniline. InChIKey: ZWKNKXAJQTZBRF-UHFFFAOYSA-N.
| Molecular formula | C12H16BClFNO2 |
|---|---|
| Molecular weight | 271.52 g/mol |
| IUPAC name | 5-chloro-4-fluoro-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)aniline |
| InChIKey | ZWKNKXAJQTZBRF-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC(=C(C=C2N)Cl)F |
Computed by PubChem (NCBI)