CAS 2638502-37-9 is the registry number for 4-Chloro-3-fluoro-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)aniline, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
4-chloro-3-fluoro-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)aniline (CAS 2638502-37-9) is a chemical compound with the molecular formula C12H16BClFNO2 and a molecular weight of 271.52 g/mol. IUPAC name: 4-chloro-3-fluoro-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)aniline. InChIKey: HULRLQYWGYAVGF-UHFFFAOYSA-N.
| Molecular formula | C12H16BClFNO2 |
|---|---|
| Molecular weight | 271.52 g/mol |
| IUPAC name | 4-chloro-3-fluoro-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)aniline |
| InChIKey | HULRLQYWGYAVGF-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC(=CC(=C2Cl)F)N |
Computed by PubChem (NCBI)