CAS 1808069-59-1 is the registry number for Rel-methyl (3R,4S)-4-(4-chlorophenyl)pyrrolidine-3-carboxylate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Methyl (3R,4S)-4-(4-chlorophenyl)pyrrolidine-3-carboxylate (CAS 1808069-59-1) is a chemical compound with the molecular formula C12H14ClNO2 and a molecular weight of 239.70 g/mol. IUPAC name: methyl (3R,4S)-4-(4-chlorophenyl)pyrrolidine-3-carboxylate. InChIKey: SFAIJGZFZQBGLO-MNOVXSKESA-N.
| Molecular formula | C12H14ClNO2 |
|---|---|
| Molecular weight | 239.70 g/mol |
| IUPAC name | methyl (3R,4S)-4-(4-chlorophenyl)pyrrolidine-3-carboxylate |
| InChIKey | SFAIJGZFZQBGLO-MNOVXSKESA-N |
| SMILES | COC(=O)[C@H]1CNC[C@@H]1C2=CC=C(C=C2)Cl |
Computed by PubChem (NCBI)