CAS 1808171-05-2 is the registry number for 2,4-Dibromo-6,7-dihydro-5H-pyrrolo[3,4-b]pyridin-5-one, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
2,4-dibromo-6,7-dihydropyrrolo[3,4-b]pyridin-5-one (CAS 1808171-05-2) is a chemical compound with the molecular formula C7H4Br2N2O and a molecular weight of 291.93 g/mol. IUPAC name: 2,4-dibromo-6,7-dihydropyrrolo[3,4-b]pyridin-5-one. InChIKey: YMSUHXADYXPZMM-UHFFFAOYSA-N.
| Molecular formula | C7H4Br2N2O |
|---|---|
| Molecular weight | 291.93 g/mol |
| IUPAC name | 2,4-dibromo-6,7-dihydropyrrolo[3,4-b]pyridin-5-one |
| InChIKey | YMSUHXADYXPZMM-UHFFFAOYSA-N |
| SMILES | C1C2=C(C(=CC(=N2)Br)Br)C(=O)N1 |
Computed by PubChem (NCBI)