CAS 290353-35-4 appears in our catalog under these names: 6,7-Dibromopyrrolo(1,2-a)pyrazin-1(2H)-one, 98%, 6,7-Dibromo-1H,2H-pyrrolo(1,2-a)pyrazin-1-one. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 10g, 50mg, 0,5g.
6,7-dibromo-2H-pyrrolo[1,2-a]pyrazin-1-one (CAS 290353-35-4) is a chemical compound with the molecular formula C7H4Br2N2O and a molecular weight of 291.93 g/mol. IUPAC name: 6,7-dibromo-2H-pyrrolo[1,2-a]pyrazin-1-one. InChIKey: DVJXLGFDWSCHKZ-UHFFFAOYSA-N.
| Molecular formula | C7H4Br2N2O |
|---|---|
| Molecular weight | 291.93 g/mol |
| IUPAC name | 6,7-dibromo-2H-pyrrolo[1,2-a]pyrazin-1-one |
| InChIKey | DVJXLGFDWSCHKZ-UHFFFAOYSA-N |
| SMILES | C1=CN2C(=CC(=C2Br)Br)C(=O)N1 |
Computed by PubChem (NCBI)