CAS 1808313-99-6 is the registry number for (2R,3S)-2-(1,5-Dimethyl-1H-pyrazol-4-yl)tetrahydrofuran-3-amine dihydrochloride, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
(2R,3S)-2-(1,5-dimethylpyrazol-4-yl)oxolan-3-amine;dihydrochloride (CAS 1808313-99-6) is a chemical compound with the molecular formula C9H17Cl2N3O and a molecular weight of 254.15 g/mol. IUPAC name: (2R,3S)-2-(1,5-dimethylpyrazol-4-yl)oxolan-3-amine;dihydrochloride. InChIKey: DKGLETFQYKIBPO-DBEJOZALSA-N.
| Molecular formula | C9H17Cl2N3O |
|---|---|
| Molecular weight | 254.15 g/mol |
| IUPAC name | (2R,3S)-2-(1,5-dimethylpyrazol-4-yl)oxolan-3-amine;dihydrochloride |
| InChIKey | DKGLETFQYKIBPO-DBEJOZALSA-N |
| SMILES | CC1=C(C=NN1C)[C@@H]2[C@H](CCO2)N.Cl.Cl |
Computed by PubChem (NCBI)