CAS 36067-72-8 appears in our catalog under these names: B-HT 933 Dihydrochloride, B–HT 933 dihydrochloride, Azepexole (dihydrochloride). Offered by: TRC, GLPBio, TargetMol, Biosynth, MedChemExpress. Available pack sizes: 250mg, 1mg, 10mg, 25mg, 5mg, 50mg, 100mg, 1 mg.
6-ethyl-4,5,7,8-tetrahydro-[1,3]oxazolo[4,5-d]azepin-2-amine;dihydrochloride (CAS 36067-72-8) is a chemical compound with the molecular formula C9H17Cl2N3O and a molecular weight of 254.15 g/mol. IUPAC name: 6-ethyl-4,5,7,8-tetrahydro-[1,3]oxazolo[4,5-d]azepin-2-amine;dihydrochloride. InChIKey: HBLPYIOKPJVFQW-UHFFFAOYSA-N.
| Molecular formula | C9H17Cl2N3O |
|---|---|
| Molecular weight | 254.15 g/mol |
| IUPAC name | 6-ethyl-4,5,7,8-tetrahydro-[1,3]oxazolo[4,5-d]azepin-2-amine;dihydrochloride |
| InChIKey | HBLPYIOKPJVFQW-UHFFFAOYSA-N |
| SMILES | CCN1CCC2=C(CC1)OC(=N2)N.Cl.Cl |
Computed by PubChem (NCBI)