CAS 180851-50-7 appears in our catalog under these names: Tos–O–C4–NH–Boc, Tos-O-C4-NH-Boc 95%, Tos-O-C4-NH-Boc, 95%, 95%, Tos-O-C4-NH-Boc, 99.70%, Toluene-4-sulfonic acid 4-tert-butoxy-carbonylamino-butyl ester, 97%. Offered by: GLPBio, Ambeed, Chemat, MedChemExpress, Fluorochem. Available pack sizes: 500mg, 100mg, 250mg, 1g, 5g, 10g, 250 mg, 500 mg.
4-[(2-methylpropan-2-yl)oxycarbonylamino]butyl 4-methylbenzenesulfonate (CAS 180851-50-7) is a chemical compound with the molecular formula C16H25NO5S and a molecular weight of 343.4 g/mol. IUPAC name: 4-[(2-methylpropan-2-yl)oxycarbonylamino]butyl 4-methylbenzenesulfonate. InChIKey: WBSGGWFVABZVGV-UHFFFAOYSA-N.
| Molecular formula | C16H25NO5S |
|---|---|
| Molecular weight | 343.4 g/mol |
| IUPAC name | 4-[(2-methylpropan-2-yl)oxycarbonylamino]butyl 4-methylbenzenesulfonate |
| InChIKey | WBSGGWFVABZVGV-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)S(=O)(=O)OCCCCNC(=O)OC(C)(C)C |
Computed by PubChem (NCBI)