CAS 473584-10-0 is the registry number for 2-((tert-Butoxycarbonyl)amino)ethyl 2,4,6-trimethylbenzenesulfonate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
2-[(2-methylpropan-2-yl)oxycarbonylamino]ethyl 2,4,6-trimethylbenzenesulfonate (CAS 473584-10-0) is a chemical compound with the molecular formula C16H25NO5S and a molecular weight of 343.4 g/mol. IUPAC name: 2-[(2-methylpropan-2-yl)oxycarbonylamino]ethyl 2,4,6-trimethylbenzenesulfonate. InChIKey: PBZZGDPOFJLGAA-UHFFFAOYSA-N.
| Molecular formula | C16H25NO5S |
|---|---|
| Molecular weight | 343.4 g/mol |
| IUPAC name | 2-[(2-methylpropan-2-yl)oxycarbonylamino]ethyl 2,4,6-trimethylbenzenesulfonate |
| InChIKey | PBZZGDPOFJLGAA-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C(=C1)C)S(=O)(=O)OCCNC(=O)OC(C)(C)C)C |
Computed by PubChem (NCBI)