Products 1809031-06-8
CAS 1809031-06-8 appears in our catalog under these names: Memantine N-β-D-glucuronide, Memantine N-b-D-glucuronide. Offered by: Chemat, Biosynth. Available pack sizes: 25mg, 50mg, 5mg, 2mg, 10mg.
(2S,3S,4S,5R,6R)-6-[[(3R,5R)-3,5-dimethyl-1-adamantyl]amino]-3,4,5-trihydroxyoxane-2-carboxylic acid (CAS 1809031-06-8) is a chemical compound with the molecular formula C18H29NO6 and a molecular weight of 355.4 g/mol. IUPAC name: (2S,3S,4S,5R,6R)-6-[[(3R,5R)-3,5-dimethyl-1-adamantyl]amino]-3,4,5-trihydroxyoxane-2-carboxylic acid. InChIKey: HYFLKMZNQYTCMY-OXJQGVFDSA-N.
| Molecular formula | C18H29NO6 |
|---|---|
| Molecular weight | 355.4 g/mol |
| IUPAC name | (2S,3S,4S,5R,6R)-6-[[(3R,5R)-3,5-dimethyl-1-adamantyl]amino]-3,4,5-trihydroxyoxane-2-carboxylic acid |
| InChIKey | HYFLKMZNQYTCMY-OXJQGVFDSA-N |
| SMILES | C[C@@]12CC3C[C@](C1)(CC(C3)(C2)N[C@H]4[C@@H]([C@H]([C@@H]([C@H](O4)C(=O)O)O)O)O)C |
Computed by PubChem (NCBI)